CAS 777-33-3 appears in our catalog under these names: N-((3S)-2,5-Dioxotetrahydro-3-furanyl)-2,2,2-trifluoroacetamide, (S)-(-)-2-(Trifluoroacetamido)succinic anhydride, 95%, (S)-(-)-2-(TRIFLUOROACETAMIDO)SUCCINIC A. Offered by: Biosynth, Combi-blocks, Sigma-Aldrich. Available pack sizes: 5g, 2g, 10g, 25g, 1g.
N-[(3S)-2,5-dioxooxolan-3-yl]-2,2,2-trifluoroacetamide (CAS 777-33-3) is a chemical compound with the molecular formula C6H4F3NO4 and a molecular weight of 211.10 g/mol. IUPAC name: N-[(3S)-2,5-dioxooxolan-3-yl]-2,2,2-trifluoroacetamide. InChIKey: ABTJOHYOWBAGTP-REOHCLBHSA-N.
| Molecular formula | C6H4F3NO4 |
|---|---|
| Molecular weight | 211.10 g/mol |
| IUPAC name | N-[(3S)-2,5-dioxooxolan-3-yl]-2,2,2-trifluoroacetamide |
| InChIKey | ABTJOHYOWBAGTP-REOHCLBHSA-N |
| SMILES | C1[C@@H](C(=O)OC1=O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)