Products 777-54-8
CAS 777-54-8 is the registry number for 2-(4-Chloro-3-methylphenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-chloro-3-methylphenoxy)propanoic acid (CAS 777-54-8) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 2-(4-chloro-3-methylphenoxy)propanoic acid. InChIKey: DRKJHOSTQZAYFT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 2-(4-chloro-3-methylphenoxy)propanoic acid |
| InChIKey | DRKJHOSTQZAYFT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC(C)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-chloro-3-methylphenoxy)propanoic acid, Propanoic acid, 2-(4-chloro-3-methylphenoxy)-, 2-((4-Chloro-m-tolyl)oxy)propionic acid, Propionic acid, 2-((4-chloro-m-tolyl)oxy)-, alpha-(4-Chloro-3-methylphenoxy)propanoic acid, 2-(4-chloro-3-methyl-phenoxy)propanoic acid, 2-(4-Chloro-3-methyl-phenoxy)-propionic acid, 2-(4-chloro-3-methylphenoxy)propanoicacid