CAS 777001-63-5 appears in our catalog under these names: Cyclopropyl(4-fluoro-3-(trifluoromethyl)phenyl)methanamine, 95%, Cyclopropyl(4-fluoro-3-(trifluoromethyl)phenyl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Cyclopropyl-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine (CAS 777001-63-5) is a chemical compound with the molecular formula C11H11F4N and a molecular weight of 233.20 g/mol. IUPAC name: cyclopropyl-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine. InChIKey: XYTFFAHMGICHMX-UHFFFAOYSA-N.
| Molecular formula | C11H11F4N |
|---|---|
| Molecular weight | 233.20 g/mol |
| IUPAC name | cyclopropyl-[4-fluoro-3-(trifluoromethyl)phenyl]methanamine |
| InChIKey | XYTFFAHMGICHMX-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=C(C=C2)F)C(F)(F)F)N |
Computed by PubChem (NCBI)