CAS 77711-81-0 is the registry number for 2-Chloro-n-[2-(4-chloro-phenylsulfanyl)-phenyl]-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
2-chloro-N-[2-(4-chlorophenyl)sulfanylphenyl]acetamide (CAS 77711-81-0) is a chemical compound with the molecular formula C14H11Cl2NOS and a molecular weight of 312.2 g/mol. IUPAC name: 2-chloro-N-[2-(4-chlorophenyl)sulfanylphenyl]acetamide. InChIKey: ZOHWUQLZHKWGQT-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NOS |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | 2-chloro-N-[2-(4-chlorophenyl)sulfanylphenyl]acetamide |
| InChIKey | ZOHWUQLZHKWGQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCl)SC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)