CAS 77721-44-9 is the registry number for 1-Azido-3-(propan-2-yl)benzene. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-azido-3-propan-2-ylbenzene (CAS 77721-44-9) is a chemical compound with the molecular formula C9H11N3 and a molecular weight of 161.20 g/mol. IUPAC name: 1-azido-3-propan-2-ylbenzene. InChIKey: MBLMBKYIUKRQRF-UHFFFAOYSA-N.
| Molecular formula | C9H11N3 |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | 1-azido-3-propan-2-ylbenzene |
| InChIKey | MBLMBKYIUKRQRF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)N=[N+]=[N-] |
Computed by PubChem (NCBI)