CAS 7776-77-4 is the registry number for rac-Griseofulvin EP Impurity C (Dehydro rac-Griseofulvin). Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexa-2,5-diene]-1',3-dione (CAS 7776-77-4) is a chemical compound with the molecular formula C17H15ClO6 and a molecular weight of 350.7 g/mol. IUPAC name: 7-chloro-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexa-2,5-diene]-1',3-dione. InChIKey: ISLYVROQSJYFAZ-UHFFFAOYSA-N.
| Molecular formula | C17H15ClO6 |
|---|---|
| Molecular weight | 350.7 g/mol |
| IUPAC name | 7-chloro-3',4,6-trimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexa-2,5-diene]-1',3-dione |
| InChIKey | ISLYVROQSJYFAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C=C(C12C(=O)C3=C(O2)C(=C(C=C3OC)OC)Cl)OC |
Computed by PubChem (NCBI)