CAS 77769-31-4 appears in our catalog under these names: C-390, C-390, Antibiotic for Culture Media Use Only. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 1g, 0,1g, 0,5g, 0,25g, 2g.
4-(9-chloro-10-phenylacridin-9-yl)-N,N-diethylaniline (CAS 77769-31-4) is a chemical compound with the molecular formula C29H27ClN2 and a molecular weight of 439.0 g/mol. IUPAC name: 4-(9-chloro-10-phenylacridin-9-yl)-N,N-diethylaniline. InChIKey: VSDSLMUSMFOWGP-UHFFFAOYSA-N.
| Molecular formula | C29H27ClN2 |
|---|---|
| Molecular weight | 439.0 g/mol |
| IUPAC name | 4-(9-chloro-10-phenylacridin-9-yl)-N,N-diethylaniline |
| InChIKey | VSDSLMUSMFOWGP-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C2(C3=CC=CC=C3N(C4=CC=CC=C42)C5=CC=CC=C5)Cl |
Computed by PubChem (NCBI)