Products 77771-61-0

CAS 77771-61-0 is the registry number for 1-Bromo-5-methoxy-2,3-dimethylbenzene 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-bromo-5-methoxy-2,3-dimethylbenzene (CAS 77771-61-0) is a chemical compound with the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. IUPAC name: 1-bromo-5-methoxy-2,3-dimethylbenzene. InChIKey: KKXOFUOMSFGHNL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrO
Molecular weight215.09 g/mol
IUPAC name1-bromo-5-methoxy-2,3-dimethylbenzene
InChIKeyKKXOFUOMSFGHNL-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C)Br)OC

Computed by PubChem (NCBI)