Products 77780-49-5

CAS 77780-49-5 is the registry number for Ceftriaxone Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-methyl-3-sulfanylidene-1H-1,2,4-triazole-5-carboxylate (CAS 77780-49-5) is a chemical compound with the molecular formula C5H7N3O2S and a molecular weight of 173.20 g/mol. IUPAC name: methyl 2-methyl-3-sulfanylidene-1H-1,2,4-triazole-5-carboxylate. InChIKey: PXKBIZAPCQBYGC-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7N3O2S
Molecular weight173.20 g/mol
IUPAC namemethyl 2-methyl-3-sulfanylidene-1H-1,2,4-triazole-5-carboxylate
InChIKeyPXKBIZAPCQBYGC-UHFFFAOYSA-N
SMILESCN1C(=S)N=C(N1)C(=O)OC

Computed by PubChem (NCBI)