Products 77794-63-9
CAS 77794-63-9 appears in our catalog under these names: Euglobal Ia2, Euglobal Ia2. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, Get quote.
1,3-dihydroxy-10a-methyl-9-(2-methylpropyl)-7-propan-2-yl-7,8,8a,9-tetrahydroxanthene-2,4-dicarbaldehyde (CAS 77794-63-9) is a chemical compound with the molecular formula C23H30O5 and a molecular weight of 386.5 g/mol. IUPAC name: 1,3-dihydroxy-10a-methyl-9-(2-methylpropyl)-7-propan-2-yl-7,8,8a,9-tetrahydroxanthene-2,4-dicarbaldehyde. InChIKey: GCAXPYWXIWWHHT-UHFFFAOYSA-N.
| Molecular formula | C23H30O5 |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | 1,3-dihydroxy-10a-methyl-9-(2-methylpropyl)-7-propan-2-yl-7,8,8a,9-tetrahydroxanthene-2,4-dicarbaldehyde |
| InChIKey | GCAXPYWXIWWHHT-UHFFFAOYSA-N |
| SMILES | CC(C)CC1C2CC(C=CC2(OC3=C(C(=C(C(=C13)O)C=O)O)C=O)C)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
euglobal IA2, Euglobal Ia1