CAS 778-09-6 appears in our catalog under these names: N-(3-Methyladamantan-1-yl)acetamide, 98%, 1-Acetylamino-3-Methyl Adamantane, N-Acetyl Demethyl Memantine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 50mg.
N-(3-methyl-1-adamantyl)acetamide (CAS 778-09-6) is a chemical compound with the molecular formula C13H21NO and a molecular weight of 207.31 g/mol. IUPAC name: N-(3-methyl-1-adamantyl)acetamide. InChIKey: SANVSQCVSVDXSG-UHFFFAOYSA-N.
| Molecular formula | C13H21NO |
|---|---|
| Molecular weight | 207.31 g/mol |
| IUPAC name | N-(3-methyl-1-adamantyl)acetamide |
| InChIKey | SANVSQCVSVDXSG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C3)(C2)C |
Computed by PubChem (NCBI)