CAS 778-67-6 is the registry number for 2,4-Dichloro-6-(2-fluorophenyl)-1,3,5-triazine, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
2,4-dichloro-6-(2-fluorophenyl)-1,3,5-triazine (CAS 778-67-6) is a chemical compound with the molecular formula C9H4Cl2FN3 and a molecular weight of 244.05 g/mol. IUPAC name: 2,4-dichloro-6-(2-fluorophenyl)-1,3,5-triazine. InChIKey: VGLNDLJTFKRYJJ-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2FN3 |
|---|---|
| Molecular weight | 244.05 g/mol |
| IUPAC name | 2,4-dichloro-6-(2-fluorophenyl)-1,3,5-triazine |
| InChIKey | VGLNDLJTFKRYJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NC(=N2)Cl)Cl)F |
Computed by PubChem (NCBI)