Products 77835-18-8

CAS 77835-18-8 is the registry number for Latamoxef Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4-methoxyphenyl)methyl 2-[4-(oxan-2-yloxy)phenyl]acetate (CAS 77835-18-8) is a chemical compound with the molecular formula C21H24O5 and a molecular weight of 356.4 g/mol. IUPAC name: (4-methoxyphenyl)methyl 2-[4-(oxan-2-yloxy)phenyl]acetate. InChIKey: JKKMOEGQFLAFQW-UHFFFAOYSA-N.

Identity
Molecular formulaC21H24O5
Molecular weight356.4 g/mol
IUPAC name(4-methoxyphenyl)methyl 2-[4-(oxan-2-yloxy)phenyl]acetate
InChIKeyJKKMOEGQFLAFQW-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)COC(=O)CC2=CC=C(C=C2)OC3CCCCO3

Computed by PubChem (NCBI)