CAS 778571-57-6 appears in our catalog under these names: L-Threonic acid magnesium salt, 95%, L–Threonic acid magnesium salt, L-Threonic acid magnesium salt, Magnesium (2R,3S)-2,3,4-trihydroxybutanoate, 95%, 95%, L-Threonic acid (magnesium), 99.0%. Offered by: Combi-blocks, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 5g, 500g, 10mg, 25mg, 50mg, 100mg.
Magnesium bis((2R,3S)-2,3,4-trihydroxybutanoate) (CAS 778571-57-6) is a chemical compound with the molecular formula C8H14MgO10 and a molecular weight of 294.50 g/mol. IUPAC name: magnesium bis((2R,3S)-2,3,4-trihydroxybutanoate). InChIKey: YVJOHOWNFPQSPP-BALCVSAKSA-L.
| Molecular formula | C8H14MgO10 |
|---|---|
| Molecular weight | 294.50 g/mol |
| IUPAC name | magnesium bis((2R,3S)-2,3,4-trihydroxybutanoate) |
| InChIKey | YVJOHOWNFPQSPP-BALCVSAKSA-L |
| SMILES | C([C@@H]([C@H](C(=O)[O-])O)O)O.C([C@@H]([C@H](C(=O)[O-])O)O)O.[Mg+2] |
Computed by PubChem (NCBI)