Products 77859-21-3
CAS 77859-21-3 appears in our catalog under these names: (1S,2R,5R)-Rel-3-azabicyclo[3.2.0]heptane-2-carboxylic acid, 95%, rel-(1S,2R,5R)-3-azabicyclo[3.2.0]heptane-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(1S,2R,5R)-3-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 77859-21-3) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: (1S,2R,5R)-3-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: WGVSZLKCAUSBGO-HCWXCVPCSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | (1S,2R,5R)-3-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | WGVSZLKCAUSBGO-HCWXCVPCSA-N |
| SMILES | C1C[C@H]2[C@@H]1CN[C@H]2C(=O)O |
Computed by PubChem (NCBI)