CAS 779-85-1 is the registry number for Phenanthro(9,10-b)oxirene. Offered by: TRC. Available pack sizes: 25mg.
Phenanthro[9,10-b]oxirene (CAS 779-85-1) is a chemical compound with the molecular formula C14H8O and a molecular weight of 192.21 g/mol. IUPAC name: phenanthro[9,10-b]oxirene. InChIKey: MNDKYWLUKLXTOS-UHFFFAOYSA-N.
| Molecular formula | C14H8O |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | phenanthro[9,10-b]oxirene |
| InChIKey | MNDKYWLUKLXTOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=C2O4 |
Computed by PubChem (NCBI)