CAS 7790-32-1 appears in our catalog under these names: Magnesium Iodate, 99%, Magnesium Iodate Tetrahydrate, Magnesium Iodate, 98%, 98%. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 1g, 25g, 5g.
Magnesium diiodate (CAS 7790-32-1) is a chemical compound with the molecular formula I2MgO6 and a molecular weight of 374.11 g/mol. IUPAC name: magnesium diiodate. InChIKey: UYNRPXVNKVAGAN-UHFFFAOYSA-L.
| Molecular formula | I2MgO6 |
|---|---|
| Molecular weight | 374.11 g/mol |
| IUPAC name | magnesium diiodate |
| InChIKey | UYNRPXVNKVAGAN-UHFFFAOYSA-L |
| SMILES | [O-]I(=O)=O.[O-]I(=O)=O.[Mg+2] |
Computed by PubChem (NCBI)