CAS 7790-37-6 is the registry number for Zinc Iodate, 99%. Offered by: Chemat Brand. Available pack sizes: on request.
Zinc diiodate (CAS 7790-37-6) is a chemical compound with the molecular formula I2O6Zn and a molecular weight of 415.2 g/mol. IUPAC name: zinc diiodate. InChIKey: MFMKGXZULQONRI-UHFFFAOYSA-L.
| Molecular formula | I2O6Zn |
|---|---|
| Molecular weight | 415.2 g/mol |
| IUPAC name | zinc diiodate |
| InChIKey | MFMKGXZULQONRI-UHFFFAOYSA-L |
| SMILES | [O-]I(=O)=O.[O-]I(=O)=O.[Zn+2] |
Computed by PubChem (NCBI)