CAS 779313-19-8 is the registry number for (4R,5R)-2,7-Dimethyloctane-4,5-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R,5R)-2,7-dimethyloctane-4,5-diamine (CAS 779313-19-8) is a chemical compound with the molecular formula C10H24N2 and a molecular weight of 172.31 g/mol. IUPAC name: (4R,5R)-2,7-dimethyloctane-4,5-diamine. InChIKey: LKIULKWWFDXWAO-NXEZZACHSA-N.
| Molecular formula | C10H24N2 |
|---|---|
| Molecular weight | 172.31 g/mol |
| IUPAC name | (4R,5R)-2,7-dimethyloctane-4,5-diamine |
| InChIKey | LKIULKWWFDXWAO-NXEZZACHSA-N |
| SMILES | CC(C)C[C@H]([C@@H](CC(C)C)N)N |
Computed by PubChem (NCBI)