CAS 779331-59-8 appears in our catalog under these names: 4-Methylthio-3-(trifluoromethyl)phenylboronic acid pinacol ester, 95%, 4-Methylthio-3-(trifluoromethyl)phenylboronic acid pinacol ester, ≥95%, ≥95%, 4-Methylthio-3-(trifluoromethyl)phenylboronic acid pinacol ester. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
4,4,5,5-tetramethyl-2-[4-methylsulfanyl-3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 779331-59-8) is a chemical compound with the molecular formula C14H18BF3O2S and a molecular weight of 318.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-methylsulfanyl-3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: PPIUFEKEWFJLJQ-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O2S |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-methylsulfanyl-3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | PPIUFEKEWFJLJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)SC)C(F)(F)F |
Computed by PubChem (NCBI)