Products 77938-04-6
CAS 77938-04-6 is the registry number for 4-Chloro-3-nitrobenzhydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
4-chloro-3-nitrobenzohydrazide (CAS 77938-04-6) is a chemical compound with the molecular formula C7H6ClN3O3 and a molecular weight of 215.59 g/mol. IUPAC name: 4-chloro-3-nitrobenzohydrazide. InChIKey: LAOXKJJONRHSDD-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O3 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 4-chloro-3-nitrobenzohydrazide |
| InChIKey | LAOXKJJONRHSDD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NN)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)