Products 77940-92-2
CAS 77940-92-2 is the registry number for (R)-Nimodipine, 99.87%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10mM/1mL, 10 mg, 25 mg, 1 mg, 5 mg, 50 mg.
3-O-(2-methoxyethyl) 5-O-propan-2-yl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 77940-92-2) is a chemical compound with the molecular formula C21H26N2O7 and a molecular weight of 418.4 g/mol. IUPAC name: 3-O-(2-methoxyethyl) 5-O-propan-2-yl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: UIAGMCDKSXEBJQ-LJQANCHMSA-N.
| Molecular formula | C21H26N2O7 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl (4R)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | UIAGMCDKSXEBJQ-LJQANCHMSA-N |
| SMILES | CC1=C([C@H](C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOC |
Computed by PubChem (NCBI)