Products 7795-95-1

CAS 7795-95-1 appears in our catalog under these names: Octane-1-sulfonyl chloride, 95%, 95%, 1-Octanesulfonyl chloride, 95%, 1–Octanesulfonyl Chloride, 1-Octanesulfonyl Chloride, 1-OCTANESULFONYL CHLORIDE, 97%. Offered by: Chemat, Combi-blocks, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 15g, 500g, 2,5g.

Structural formula: {0} (CAS {1})

Octane-1-sulfonyl chloride (CAS 7795-95-1) is a chemical compound with the molecular formula C8H17ClO2S and a molecular weight of 212.74 g/mol. IUPAC name: octane-1-sulfonyl chloride. InChIKey: WIVNTNLDTMNDNO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClO2S
Molecular weight212.74 g/mol
IUPAC nameoctane-1-sulfonyl chloride
InChIKeyWIVNTNLDTMNDNO-UHFFFAOYSA-N
SMILESCCCCCCCCS(=O)(=O)Cl

Computed by PubChem (NCBI)