CAS 77976-03-5 is the registry number for 4-Acetylbenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-acetylbenzoyl fluoride (CAS 77976-03-5) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: 4-acetylbenzoyl fluoride. InChIKey: KWTZUUATDFNMLK-UHFFFAOYSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 4-acetylbenzoyl fluoride |
| InChIKey | KWTZUUATDFNMLK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)F |
Computed by PubChem (NCBI)