Products 77976-03-5

CAS 77976-03-5 is the registry number for 4-Acetylbenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-acetylbenzoyl fluoride (CAS 77976-03-5) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: 4-acetylbenzoyl fluoride. InChIKey: KWTZUUATDFNMLK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7FO2
Molecular weight166.15 g/mol
IUPAC name4-acetylbenzoyl fluoride
InChIKeyKWTZUUATDFNMLK-UHFFFAOYSA-N
SMILESCC(=O)C1=CC=C(C=C1)C(=O)F

Computed by PubChem (NCBI)