Products 77976-05-7

CAS 77976-05-7 is the registry number for 3-Chlorobenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chlorobenzoyl fluoride (CAS 77976-05-7) is a chemical compound with the molecular formula C7H4ClFO and a molecular weight of 158.56 g/mol. IUPAC name: 3-chlorobenzoyl fluoride. InChIKey: ZJJKFUVNCPTQON-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClFO
Molecular weight158.56 g/mol
IUPAC name3-chlorobenzoyl fluoride
InChIKeyZJJKFUVNCPTQON-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)C(=O)F

Computed by PubChem (NCBI)