CAS 780009-55-4 appears in our catalog under these names: (S)-2-Amino-3-(4,5-dimethoxy-2-nitrobenzyloxy)propanoic acid, 95%, DMNB-caged-Serine, 95+%, DMNB–caged–Serine, DMNB-caged-Serine, (S)-2-Amino-3-((4,5-dimethoxy-2-nitrobenzyl)oxy)propanoic acid, 99.48%, 99.48%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 10mg, 25mg, 50mg, 5mg, 10 mg.
(2S)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]propanoic acid (CAS 780009-55-4) is a chemical compound with the molecular formula C12H16N2O7 and a molecular weight of 300.26 g/mol. IUPAC name: (2S)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]propanoic acid. InChIKey: HYSPNOMZFGNKBR-QMMMGPOBSA-N.
| Molecular formula | C12H16N2O7 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | (2S)-2-amino-3-[(4,5-dimethoxy-2-nitrophenyl)methoxy]propanoic acid |
| InChIKey | HYSPNOMZFGNKBR-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C(C(=C1)COC[C@@H](C(=O)O)N)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)