CAS 78015-49-3 is the registry number for Riluzole Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-bis[4-(trifluoromethoxy)phenyl]urea (CAS 78015-49-3) is a chemical compound with the molecular formula C15H10F6N2O3 and a molecular weight of 380.24 g/mol. IUPAC name: 1,3-bis[4-(trifluoromethoxy)phenyl]urea. InChIKey: RSCCKXHOLGSHCN-UHFFFAOYSA-N.
| Molecular formula | C15H10F6N2O3 |
|---|---|
| Molecular weight | 380.24 g/mol |
| IUPAC name | 1,3-bis[4-(trifluoromethoxy)phenyl]urea |
| InChIKey | RSCCKXHOLGSHCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)OC(F)(F)F |
Computed by PubChem (NCBI)