CAS 78018-53-8 is the registry number for 2-Methyl-1,4-bis(trimethylsiloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
Trimethyl-(2-methyl-4-trimethylsilyloxyphenoxy)silane (CAS 78018-53-8) is a chemical compound with the molecular formula C13H24O2Si2 and a molecular weight of 268.50 g/mol. IUPAC name: trimethyl-(2-methyl-4-trimethylsilyloxyphenoxy)silane. InChIKey: IPYOHMJSEPFQSQ-UHFFFAOYSA-N.
| Molecular formula | C13H24O2Si2 |
|---|---|
| Molecular weight | 268.50 g/mol |
| IUPAC name | trimethyl-(2-methyl-4-trimethylsilyloxyphenoxy)silane |
| InChIKey | IPYOHMJSEPFQSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)O[Si](C)(C)C)O[Si](C)(C)C |
Computed by PubChem (NCBI)