Products 78022-19-2

CAS 78022-19-2 is the registry number for Methyl 4–((dimethoxyphosphoryl)methyl)benzoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg.

Structural formula: {0} (CAS {1})

Methyl 4-(dimethoxyphosphorylmethyl)benzoate (CAS 78022-19-2) is a chemical compound with the molecular formula C11H15O5P and a molecular weight of 258.21 g/mol. IUPAC name: methyl 4-(dimethoxyphosphorylmethyl)benzoate. InChIKey: IGTOJTIOIGZJBM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15O5P
Molecular weight258.21 g/mol
IUPAC namemethyl 4-(dimethoxyphosphorylmethyl)benzoate
InChIKeyIGTOJTIOIGZJBM-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)CP(=O)(OC)OC

Computed by PubChem (NCBI)