Products 78071-34-8

CAS 78071-34-8 is the registry number for 4-Cyanothiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-cyanothiophene-3-carboxylic acid (CAS 78071-34-8) is a chemical compound with the molecular formula C6H3NO2S and a molecular weight of 153.16 g/mol. IUPAC name: 4-cyanothiophene-3-carboxylic acid. InChIKey: CGTPGBPWMGOBEY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3NO2S
Molecular weight153.16 g/mol
IUPAC name4-cyanothiophene-3-carboxylic acid
InChIKeyCGTPGBPWMGOBEY-UHFFFAOYSA-N
SMILESC1=C(C(=CS1)C(=O)O)C#N

Computed by PubChem (NCBI)