Products 780760-09-0
CAS 780760-09-0 is the registry number for (1R)–1–(5–Methyl–2–furyl)–1–propanamine， D–Tartaric acid. Offered by: GLPBio. Available pack sizes: 250mg.
(2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-(5-methylfuran-2-yl)propan-1-amine (CAS 780760-09-0) is a chemical compound with the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-(5-methylfuran-2-yl)propan-1-amine. InChIKey: LHKBDXXZMOBBNB-DOIQAPIBSA-N.
| Molecular formula | C12H19NO7 |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-(5-methylfuran-2-yl)propan-1-amine |
| InChIKey | LHKBDXXZMOBBNB-DOIQAPIBSA-N |
| SMILES | CC[C@H](C1=CC=C(O1)C)N.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)