CAS 780782-29-8 is the registry number for tert-Butyl (R)-3-hydroxy-3,6-dihydropyridine-1(2H)-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3R)-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 780782-29-8) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: tert-butyl (3R)-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: NICJOYHYEDFTIX-MRVPVSSYSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | tert-butyl (3R)-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | NICJOYHYEDFTIX-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=C[C@H](C1)O |
Computed by PubChem (NCBI)