CAS 780811-54-3 appears in our catalog under these names: 3,5-Dinitrobenzenethiol, 97%, 3,5-Dinitrobenzenethiol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 500mg, 1000mg, 2000mg, 5000mg.
3,5-dinitrobenzenethiol (CAS 780811-54-3) is a chemical compound with the molecular formula C6H4N2O4S and a molecular weight of 200.17 g/mol. IUPAC name: 3,5-dinitrobenzenethiol. InChIKey: XPORHLAFAGPQJI-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4S |
|---|---|
| Molecular weight | 200.17 g/mol |
| IUPAC name | 3,5-dinitrobenzenethiol |
| InChIKey | XPORHLAFAGPQJI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])S)[N+](=O)[O-] |
Computed by PubChem (NCBI)