CAS 78098-50-7 is the registry number for 4-amino-6-((2-hydroxyvinyl)amino)-1,3,5-triazin-2(5H)-one dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-4-[[(E)-2-hydroxyethenyl]amino]-1H-1,3,5-triazin-2-one (CAS 78098-50-7) is a chemical compound with the molecular formula C5H7N5O2 and a molecular weight of 169.14 g/mol. IUPAC name: 6-amino-4-[[(E)-2-hydroxyethenyl]amino]-1H-1,3,5-triazin-2-one. InChIKey: PZKMYFKPCOZSLE-OWOJBTEDSA-N.
| Molecular formula | C5H7N5O2 |
|---|---|
| Molecular weight | 169.14 g/mol |
| IUPAC name | 6-amino-4-[[(E)-2-hydroxyethenyl]amino]-1H-1,3,5-triazin-2-one |
| InChIKey | PZKMYFKPCOZSLE-OWOJBTEDSA-N |
| SMILES | C(=C/O)\NC1=NC(=O)NC(=N1)N |
Computed by PubChem (NCBI)