Products 78133-46-7

CAS 78133-46-7 is the registry number for Phosphonic Acid, 4-Pyridinyl-, Dimethyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

4-dimethoxyphosphorylpyridine (CAS 78133-46-7) is a chemical compound with the molecular formula C7H10NO3P and a molecular weight of 187.13 g/mol. IUPAC name: 4-dimethoxyphosphorylpyridine. InChIKey: KPBUFZDFQXGSPT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10NO3P
Molecular weight187.13 g/mol
IUPAC name4-dimethoxyphosphorylpyridine
InChIKeyKPBUFZDFQXGSPT-UHFFFAOYSA-N
SMILESCOP(=O)(C1=CC=NC=C1)OC

Computed by PubChem (NCBI)