CAS 78138-99-5 is the registry number for 3o,5o-dibenzyl-2-deoxy-1,4-ribonolactone. Offered by: TRC. Available pack sizes: 250mg.
(4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-one (CAS 78138-99-5) is a chemical compound with the molecular formula C19H20O4 and a molecular weight of 312.4 g/mol. IUPAC name: (4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-one. InChIKey: ZVNMIMFCDTZKSU-ZWKOTPCHSA-N.
| Molecular formula | C19H20O4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-one |
| InChIKey | ZVNMIMFCDTZKSU-ZWKOTPCHSA-N |
| SMILES | C1[C@@H]([C@H](OC1=O)COCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)