CAS 781652-57-1 appears in our catalog under these names: 3-Cyano-n-(1,3-diphenyl-1h-pyrazol-5-yl)benzamide, 95%, CDPPB/ 99.39% (existing batch purity), CDPPB, mGluR5 Ligand, CDPPB, CDPPB 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg.
3-cyano-N-(1,3-diphenylpyrazol-5-yl)benzamide (CAS 781652-57-1) is a chemical compound with the molecular formula C23H16N4O and a molecular weight of 364.4 g/mol. IUPAC name: 3-cyano-N-(1,3-diphenylpyrazol-5-yl)benzamide. InChIKey: BKUIZWILNWHFHD-UHFFFAOYSA-N.
| Molecular formula | C23H16N4O |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 3-cyano-N-(1,3-diphenylpyrazol-5-yl)benzamide |
| InChIKey | BKUIZWILNWHFHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=C2)NC(=O)C3=CC=CC(=C3)C#N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)