Products 78196-92-6

CAS 78196-92-6 is the registry number for 2–Hydroxy–2,2–di(thiophen–3–yl)acetic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-hydroxy-2,2-di(thiophen-3-yl)acetic acid (CAS 78196-92-6) is a chemical compound with the molecular formula C10H8O3S2 and a molecular weight of 240.3 g/mol. IUPAC name: 2-hydroxy-2,2-di(thiophen-3-yl)acetic acid. InChIKey: LPRPEPVLUJPOFT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O3S2
Molecular weight240.3 g/mol
IUPAC name2-hydroxy-2,2-di(thiophen-3-yl)acetic acid
InChIKeyLPRPEPVLUJPOFT-UHFFFAOYSA-N
SMILESC1=CSC=C1C(C2=CSC=C2)(C(=O)O)O

Computed by PubChem (NCBI)