CAS 78196-92-6 is the registry number for 2–Hydroxy–2,2–di(thiophen–3–yl)acetic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-hydroxy-2,2-di(thiophen-3-yl)acetic acid (CAS 78196-92-6) is a chemical compound with the molecular formula C10H8O3S2 and a molecular weight of 240.3 g/mol. IUPAC name: 2-hydroxy-2,2-di(thiophen-3-yl)acetic acid. InChIKey: LPRPEPVLUJPOFT-UHFFFAOYSA-N.
| Molecular formula | C10H8O3S2 |
|---|---|
| Molecular weight | 240.3 g/mol |
| IUPAC name | 2-hydroxy-2,2-di(thiophen-3-yl)acetic acid |
| InChIKey | LPRPEPVLUJPOFT-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C(C2=CSC=C2)(C(=O)O)O |
Computed by PubChem (NCBI)