CAS 782-55-8 is the registry number for 3-(1H-Benzoimidazol-2-yl)-1,1,1-trifluoro-propan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
3-(1H-benzimidazol-2-yl)-1,1,1-trifluoropropan-2-one (CAS 782-55-8) is a chemical compound with the molecular formula C10H7F3N2O and a molecular weight of 228.17 g/mol. IUPAC name: 3-(1H-benzimidazol-2-yl)-1,1,1-trifluoropropan-2-one. InChIKey: HJYPHXMVQPUHIO-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2O |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 3-(1H-benzimidazol-2-yl)-1,1,1-trifluoropropan-2-one |
| InChIKey | HJYPHXMVQPUHIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)