CAS 782475-37-0 appears in our catalog under these names: Br–PEG3–C2–Boc, Bromo-peg3-t-butyl ester 95%, Bromo-peg3-t-butyl ester, 98%, 98%, Br-PEG3-C2-Boc, 98.0%, Br-PEG3-C2-Boc, 97%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 50g, 10g, 5 g.
Tert-butyl 3-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]propanoate (CAS 782475-37-0) is a chemical compound with the molecular formula C13H25BrO5 and a molecular weight of 341.24 g/mol. IUPAC name: tert-butyl 3-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]propanoate. InChIKey: ISAHSVMMFPHXFG-UHFFFAOYSA-N.
| Molecular formula | C13H25BrO5 |
|---|---|
| Molecular weight | 341.24 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]propanoate |
| InChIKey | ISAHSVMMFPHXFG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCBr |
Computed by PubChem (NCBI)