Products 782482-50-2
CAS 782482-50-2 is the registry number for (S),-2-(tert-Butylamino),-1-(2,4-difluorophenyl),ethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(1S)-2-(tert-butylamino)-1-(2,4-difluorophenyl)ethanol (CAS 782482-50-2) is a chemical compound with the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. IUPAC name: (1S)-2-(tert-butylamino)-1-(2,4-difluorophenyl)ethanol. InChIKey: HWKDKMWNIGHDAE-LLVKDONJSA-N.
| Molecular formula | C12H17F2NO |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (1S)-2-(tert-butylamino)-1-(2,4-difluorophenyl)ethanol |
| InChIKey | HWKDKMWNIGHDAE-LLVKDONJSA-N |
| SMILES | CC(C)(C)NC[C@H](C1=C(C=C(C=C1)F)F)O |
Computed by PubChem (NCBI)