CAS 78304-55-9 is the registry number for 6-(Bromomethyl)-2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(bromomethyl)-2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidine;hydrobromide (CAS 78304-55-9) is a chemical compound with the molecular formula C9H12Br2N2O and a molecular weight of 324.01 g/mol. IUPAC name: 6-(bromomethyl)-2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidine;hydrobromide. InChIKey: FIMYGNBKOXJSER-UHFFFAOYSA-N.
| Molecular formula | C9H12Br2N2O |
|---|---|
| Molecular weight | 324.01 g/mol |
| IUPAC name | 6-(bromomethyl)-2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidine;hydrobromide |
| InChIKey | FIMYGNBKOXJSER-UHFFFAOYSA-N |
| SMILES | CC1=C2CC(OC2=NC(=N1)C)CBr.Br |
Computed by PubChem (NCBI)