CAS 78380-28-6 is the registry number for 5-Chlorothiophene-2-sulfonohydrazide 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-chlorothiophene-2-sulfonohydrazide (CAS 78380-28-6) is a chemical compound with the molecular formula C4H5ClN2O2S2 and a molecular weight of 212.7 g/mol. IUPAC name: 5-chlorothiophene-2-sulfonohydrazide. InChIKey: VVSLQYNHYOIDRL-UHFFFAOYSA-N.
| Molecular formula | C4H5ClN2O2S2 |
|---|---|
| Molecular weight | 212.7 g/mol |
| IUPAC name | 5-chlorothiophene-2-sulfonohydrazide |
| InChIKey | VVSLQYNHYOIDRL-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Cl)S(=O)(=O)NN |
Computed by PubChem (NCBI)