CAS 78389-87-4 is the registry number for Trimethylsilylethynylzinc chloride. Offered by: GLPBio. Available pack sizes: 100ml, 25ml, 5ml.
Chlorozinc(1+);ethynyl(trimethyl)silane (CAS 78389-87-4) is a chemical compound with the molecular formula C5H9ClSiZn and a molecular weight of 198.0 g/mol. IUPAC name: chlorozinc(1+);ethynyl(trimethyl)silane. InChIKey: ODBFHNBEIUVFJZ-UHFFFAOYSA-M.
| Molecular formula | C5H9ClSiZn |
|---|---|
| Molecular weight | 198.0 g/mol |
| IUPAC name | chlorozinc(1+);ethynyl(trimethyl)silane |
| InChIKey | ODBFHNBEIUVFJZ-UHFFFAOYSA-M |
| SMILES | C[Si](C)(C)C#[C-].Cl[Zn+] |
Computed by PubChem (NCBI)