Products 78399-78-7
CAS 78399-78-7 appears in our catalog under these names: m-Nitrobenzoic-d4 Acid, 3-Nitrobenzoic-d4 Acid, 98 atom % D, min 98% Chemical Purity, 3-Nitrobenzoic acid-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,5g, 0,25g, 10 mg, 100 mg.
2,3,4,6-tetradeuterio-5-nitrobenzoic acid (CAS 78399-78-7) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 171.14 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-nitrobenzoic acid. InChIKey: AFPHTEQTJZKQAQ-RHQRLBAQSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 171.14 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-nitrobenzoic acid |
| InChIKey | AFPHTEQTJZKQAQ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[N+](=O)[O-])[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)