Products 78399-79-8
CAS 78399-79-8 appears in our catalog under these names: 3-Aminobenzoic-d4 Acid, >95% (HPLC), 3-Aminobenzoic-2,4,5,6-d4 Acid, 99 atom % D, min 98% Chemical Purity, 3–Aminobenzoic–d4 Acid, 3-Aminobenzoic acid-d4. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,1g, 0,05g, 10 mg, 100 mg.
3-amino-2,4,5,6-tetradeuteriobenzoic acid (CAS 78399-79-8) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 141.16 g/mol. IUPAC name: 3-amino-2,4,5,6-tetradeuteriobenzoic acid. InChIKey: XFDUHJPVQKIXHO-RHQRLBAQSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 141.16 g/mol |
| IUPAC name | 3-amino-2,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | XFDUHJPVQKIXHO-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N)[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)