CAS 78430-35-0 is the registry number for Methyl 2–hydroxy–2–phenyl–2–(p–tolyl)acetate. Offered by: GLPBio. Available pack sizes: 250mg.
Methyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate (CAS 78430-35-0) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: methyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate. InChIKey: LZVNPXGXPIHQTM-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | methyl 2-hydroxy-2-(4-methylphenyl)-2-phenylacetate |
| InChIKey | LZVNPXGXPIHQTM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C(=O)OC)O |
Computed by PubChem (NCBI)