Products 78469-86-0
CAS 78469-86-0 appears in our catalog under these names: ((2R，3S)–3–((Benzyloxy)methyl)oxiran–2–yl)methyl 4–nitrobenzoate, (2R,3S)-(+)-3-(BENZYLOXYMETHYL)OXIRANE-&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 5G.
[(2R,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]methyl 4-nitrobenzoate (CAS 78469-86-0) is a chemical compound with the molecular formula C18H17NO6 and a molecular weight of 343.3 g/mol. IUPAC name: [(2R,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]methyl 4-nitrobenzoate. InChIKey: XBAOYRZETQXAAE-DLBZAZTESA-N.
| Molecular formula | C18H17NO6 |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | [(2R,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]methyl 4-nitrobenzoate |
| InChIKey | XBAOYRZETQXAAE-DLBZAZTESA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H]2[C@H](O2)COC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)