CAS 784990-49-4 is the registry number for 7-Amino-2,4-dimethylpyrimido[2,1-a]phthalazin-5-ium, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethylpyrimido[2,1-a]phthalazin-5-ium-7-amine (CAS 784990-49-4) is a chemical compound with the molecular formula C13H13N4+ and a molecular weight of 225.27 g/mol. IUPAC name: 2,4-dimethylpyrimido[2,1-a]phthalazin-5-ium-7-amine. InChIKey: OFXYDDLWAILSCX-UHFFFAOYSA-N.
| Molecular formula | C13H13N4+ |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 2,4-dimethylpyrimido[2,1-a]phthalazin-5-ium-7-amine |
| InChIKey | OFXYDDLWAILSCX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=[N+]2C(=N1)C3=CC=CC=C3C(=N2)N)C |
Computed by PubChem (NCBI)