CAS 78525-34-5 appears in our catalog under these names: 4,4',4'',4'''–(Ethene–1,1,2,2–tetrayl)tetraaniline, 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline, 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline, >95.0%(HPLC), Benzenamine, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis-, 97%, 97%, 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline, 95%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 100mg, 250mg.
4-[1,2,2-tris(4-aminophenyl)ethenyl]aniline (CAS 78525-34-5) is a chemical compound with the molecular formula C26H24N4 and a molecular weight of 392.5 g/mol. IUPAC name: 4-[1,2,2-tris(4-aminophenyl)ethenyl]aniline. InChIKey: JGUVAGVIFMBVCK-UHFFFAOYSA-N.
| Molecular formula | C26H24N4 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | 4-[1,2,2-tris(4-aminophenyl)ethenyl]aniline |
| InChIKey | JGUVAGVIFMBVCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=C(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N)N |
Computed by PubChem (NCBI)